C28H32N4O4 — CID 10163326
3-(4-phenylphenyl)-3-[[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoic acid (PubChem CID 10163326) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10163326 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)CCCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N4O4/c1-20(31-26(33)12-6-8-18-30-25-11-5-7-17-29-25)28(36)32-24(19-27(34)35)23-15-13-22(14-16-23)21-9-3-2-4-10-21/h2-5,7,9-11,13-17,20,24H,6,8,12,18-19H2,1H3,(H,29,30)(H,31,33)(H,32,36)(H,34,35)/t20-,24?/m1/s1 |
| InChIKey | DJBGPUVXNUYDND-CGHJUBPDSA-N |
| XLogP | 4.17 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|