C19H18N6O6S2 — CID 10163426
1-N',3-N'-dimethyl-1-N',3-N'-bis(4-nitrobenzenecarbothioyl)propanedihydrazide (PubChem CID 10163426) has the molecular formula C19H18N6O6S2 and a molecular weight of 490.52 g/mol. Its IUPAC name is 1-N',3-N'-dimethyl-1-N',3-N'-bis(4-nitrobenzenecarbothioyl)propanedihydrazide.
| Compound Name | 1-N',3-N'-dimethyl-1-N',3-N'-bis(4-nitrobenzenecarbothioyl)propanedihydrazide |
|---|---|
| PubChem CID | 10163426 |
| Molecular Formula | C19H18N6O6S2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 1-N',3-N'-dimethyl-1-N',3-N'-bis(4-nitrobenzenecarbothioyl)propanedihydrazide |
| SMILES | CN(NC(=O)CC(=O)NN(C)C(=S)c1ccc([N+](=O)[O-])cc1)C(=S)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N6O6S2/c1-22(18(32)12-3-7-14(8-4-12)24(28)29)20-16(26)11-17(27)21-23(2)19(33)13-5-9-15(10-6-13)25(30)31/h3-10H,11H2,1-2H3,(H,20,26)(H,21,27) |
| InChIKey | NEMXUGOJGKLMKE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|