C30H36O6 — CID 10163576
[(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxochromene-3-carboxylate (PubChem CID 10163576) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxochromene-3-carboxylate.
| Compound Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 10163576 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxochromene-3-carboxylate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)c2coc3ccccc3c2=O)[C@@]2(C)C3C(=O)CCC3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H36O6/c1-6-28(4)15-23(36-27(34)20-16-35-22-10-8-7-9-19(22)24(20)32)29(5)17(2)11-13-30(18(3)26(28)33)14-12-21(31)25(29)30/h6-10,16-18,23,25-26,33H,1,11-15H2,2-5H3/t17-,18+,23-,25?,26+,28-,29+,30?/m1/s1 |
| InChIKey | OVLJCCIGYGXFKC-QYCPIFBPSA-N |
| XLogP | 5.31 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|