About N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline
N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline (PubChem CID 10163645) has the molecular formula C30H37F2N3O
and a molecular weight of 493.64 g/mol. Its IUPAC name is N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline.
Molecular Properties
| Compound Name | N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline |
| PubChem CID | 10163645 |
| Molecular Formula | C30H37F2N3O |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline |
| SMILES | COC(CNc1ccccc1)CN1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H37F2N3O/c1-36-29(22-33-28-6-3-2-4-7-28)23-35-20-18-34(19-21-35)17-5-8-30(24-9-13-26(31)14-10-24)25-11-15-27(32)16-12-25/h2-4,6-7,9-16,29-30,33H,5,8,17-23H2,1H3 |
| InChIKey | AKDRTSVLFIAYML-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline?
The IUPAC name of N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline (CID 10163645) is N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline.
What is the SMILES notation for N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline?
The canonical SMILES for N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline is COC(CNc1ccccc1)CN1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline?
The InChIKey is AKDRTSVLFIAYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37F2N3O/c1-36-29(22-33-28-6-3-2-4-7-28)23-35-20-18-34(19-21-35)17-5-8-30(24-9-13-26(31)14-10-24)25-11-15-27(32)16-12-25/h2-4,6-7,9-16,29-30,33H,5,8,17-23H2,1H3.
What are the key properties of N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline?
N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline has a molecular weight of 493.64 g/mol, XLogP of 5.62, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-2-methoxypropyl]aniline is sourced from PubChem (CID 10163645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).