About 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid
4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid (PubChem CID 10164000) has the molecular formula C19H19Br2NO5
and a molecular weight of 501.17 g/mol. Its IUPAC name is 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid |
| PubChem CID | 10164000 |
| Molecular Formula | C19H19Br2NO5 |
| Molecular Weight | 501.17 g/mol |
| Exact Mass | 498.96 |
| IUPAC Name | 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid |
| SMILES | CC(C)c1cc(Oc2c(Br)cc(NC(=O)CCC(=O)O)cc2Br)ccc1O |
| InChI | InChI=1S/C19H19Br2NO5/c1-10(2)13-9-12(3-4-16(13)23)27-19-14(20)7-11(8-15(19)21)22-17(24)5-6-18(25)26/h3-4,7-10,23H,5-6H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | YWHRVGJEXWWYIP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.17 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid?
The IUPAC name of 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid (CID 10164000) is 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid?
The canonical SMILES for 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid is CC(C)c1cc(Oc2c(Br)cc(NC(=O)CCC(=O)O)cc2Br)ccc1O.
What is the InChIKey of 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid?
The InChIKey is YWHRVGJEXWWYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Br2NO5/c1-10(2)13-9-12(3-4-16(13)23)27-19-14(20)7-11(8-15(19)21)22-17(24)5-6-18(25)26/h3-4,7-10,23H,5-6H2,1-2H3,(H,22,24)(H,25,26).
What are the key properties of 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid?
4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid has a molecular weight of 501.17 g/mol, XLogP of 5.64, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoic acid is sourced from PubChem (CID 10164000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).