C29H34N4O4 — CID 10164088
3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoic acid (PubChem CID 10164088) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10164088 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoic acid |
| SMILES | CC[C@H](NC(=O)CCCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N4O4/c1-2-24(32-27(34)13-7-9-19-31-26-12-6-8-18-30-26)29(37)33-25(20-28(35)36)23-16-14-22(15-17-23)21-10-4-3-5-11-21/h3-6,8,10-12,14-18,24-25H,2,7,9,13,19-20H2,1H3,(H,30,31)(H,32,34)(H,33,37)(H,35,36)/t24-,25?/m0/s1 |
| InChIKey | JVBHKQMROKXSKI-SKCDSABHSA-N |
| XLogP | 4.56 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|