C32H48N4O — CID 10164225
(3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 10164225) has the molecular formula C32H48N4O and a molecular weight of 504.76 g/mol. Its IUPAC name is (3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10164225 |
| Molecular Formula | C32H48N4O |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | (3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H](CN1CCN(c2ncccn2)CC1)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C32H48N4O/c1-22(21-35-17-19-36(20-18-35)29-33-15-6-16-34-29)24-8-9-25-23-7-10-27-30(2,3)28(37)12-14-32(27,5)26(23)11-13-31(24,25)4/h6,9,15-16,22,24,27-28,37H,7-8,10-14,17-21H2,1-5H3/t22-,24+,27-,28-,31+,32+/m0/s1 |
| InChIKey | GKBHGYCSYJXRHT-QXPUGNAASA-N |
| XLogP | 5.87 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |