About (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate
(2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate (PubChem CID 10164370) has the molecular formula C29H28F3N3O2
and a molecular weight of 507.56 g/mol. Its IUPAC name is (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate.
Molecular Properties
| Compound Name | (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate |
| PubChem CID | 10164370 |
| Molecular Formula | C29H28F3N3O2 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate |
| SMILES | Cc1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CCCCCCNC(=O)Oc1ccccc1F |
| InChI | InChI=1S/C29H28F3N3O2/c1-20-34-27(21-10-14-23(30)15-11-21)28(22-12-16-24(31)17-13-22)35(20)19-7-3-2-6-18-33-29(36)37-26-9-5-4-8-25(26)32/h4-5,8-17H,2-3,6-7,18-19H2,1H3,(H,33,36) |
| InChIKey | FROPPAHABGJTLA-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate?
The IUPAC name of (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate (CID 10164370) is (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate.
What is the SMILES notation for (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate?
The canonical SMILES for (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate is Cc1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CCCCCCNC(=O)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate?
The InChIKey is FROPPAHABGJTLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28F3N3O2/c1-20-34-27(21-10-14-23(30)15-11-21)28(22-12-16-24(31)17-13-22)35(20)19-7-3-2-6-18-33-29(36)37-26-9-5-4-8-25(26)32/h4-5,8-17H,2-3,6-7,18-19H2,1H3,(H,33,36).
What are the key properties of (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate?
(2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate has a molecular weight of 507.56 g/mol, XLogP of 7.29, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate is sourced from PubChem (CID 10164370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).