About 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol
4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol (PubChem CID 10164403) has the molecular formula C22H38O9P2
and a molecular weight of 508.49 g/mol. Its IUPAC name is 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol |
| PubChem CID | 10164403 |
| Molecular Formula | C22H38O9P2 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(C=C(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(OC)c1O |
| InChI | InChI=1S/C22H38O9P2/c1-14(2)28-32(24,29-15(3)4)21(33(25,30-16(5)6)31-17(7)8)13-18-11-19(26-9)22(23)20(12-18)27-10/h11-17,23H,1-10H3 |
| InChIKey | BTHSLJFPSCOVJZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol?
The IUPAC name of 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol (CID 10164403) is 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol.
What is the SMILES notation for 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol?
The canonical SMILES for 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol is COc1cc(C=C(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(OC)c1O.
What is the InChIKey of 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol?
The InChIKey is BTHSLJFPSCOVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O9P2/c1-14(2)28-32(24,29-15(3)4)21(33(25,30-16(5)6)31-17(7)8)13-18-11-19(26-9)22(23)20(12-18)27-10/h11-17,23H,1-10H3.
What are the key properties of 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol?
4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol has a molecular weight of 508.49 g/mol, XLogP of 6.79, 13 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-2,6-dimethoxyphenol is sourced from PubChem (CID 10164403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).