C30H42N2O5 — CID 10164519
(3S,6S)-1,3-dimethyl-4-octyl-6-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione (PubChem CID 10164519) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is (3S,6S)-1,3-dimethyl-4-octyl-6-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-1,3-dimethyl-4-octyl-6-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10164519 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (3S,6S)-1,3-dimethyl-4-octyl-6-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)[C@H](Cc2ccc(-c3cc(OC)c(OC)c(OC)c3)cc2)N(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C30H42N2O5/c1-7-8-9-10-11-12-17-32-21(2)29(33)31(3)25(30(32)34)18-22-13-15-23(16-14-22)24-19-26(35-4)28(37-6)27(20-24)36-5/h13-16,19-21,25H,7-12,17-18H2,1-6H3/t21-,25-/m0/s1 |
| InChIKey | KKWAMGGZQCLTJI-OFVILXPXSA-N |
| XLogP | 5.34 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|