C17H14Cl3F6N3S — CID 10164617
5-[[cyclopropylmethyl(2,2,2-trifluoroethyl)amino]methyl]-N-(2,4,6-trichlorophenyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 10164617) has the molecular formula C17H14Cl3F6N3S and a molecular weight of 512.73 g/mol. Its IUPAC name is 5-[[cyclopropylmethyl(2,2,2-trifluoroethyl)amino]methyl]-N-(2,4,6-trichlorophenyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[[cyclopropylmethyl(2,2,2-trifluoroethyl)amino]methyl]-N-(2,4,6-trichlorophenyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10164617 |
| Molecular Formula | C17H14Cl3F6N3S |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 510.99 |
| IUPAC Name | 5-[[cyclopropylmethyl(2,2,2-trifluoroethyl)amino]methyl]-N-(2,4,6-trichlorophenyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)CN(Cc1sc(Nc2c(Cl)cc(Cl)cc2Cl)nc1C(F)(F)F)CC1CC1 |
| InChI | InChI=1S/C17H14Cl3F6N3S/c18-9-3-10(19)13(11(20)4-9)27-15-28-14(17(24,25)26)12(30-15)6-29(5-8-1-2-8)7-16(21,22)23/h3-4,8H,1-2,5-7H2,(H,27,28) |
| InChIKey | ZQHMCESGMBJNKW-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |