C25H24ClF3N6O — CID 10164799
4-[2-(3-chlorophenyl)-6-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine (PubChem CID 10164799) has the molecular formula C25H24ClF3N6O and a molecular weight of 516.96 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)-6-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine.
| Compound Name | 4-[2-(3-chlorophenyl)-6-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 10164799 |
| Molecular Formula | C25H24ClF3N6O |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 4-[2-(3-chlorophenyl)-6-(trifluoromethyl)pyrazolo[1,5-a]pyridin-3-yl]-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccc2c(-c3ccnc(NCCCN4CCOCC4)n3)c(-c3cccc(Cl)c3)nn2c1 |
| InChI | InChI=1S/C25H24ClF3N6O/c26-19-4-1-3-17(15-19)23-22(21-6-5-18(25(27,28)29)16-35(21)33-23)20-7-9-31-24(32-20)30-8-2-10-34-11-13-36-14-12-34/h1,3-7,9,15-16H,2,8,10-14H2,(H,30,31,32) |
| InChIKey | XIUALAVAPLGUOY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|