C25H22F7NO3 — CID 10164805
1,1,1-trifluoro-3-[3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol (PubChem CID 10164805) has the molecular formula C25H22F7NO3 and a molecular weight of 517.44 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10164805 |
| Molecular Formula | C25H22F7NO3 |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
| SMILES | Cc1cccc(Oc2cccc(N(Cc3cccc(OC(F)(F)C(F)F)c3)CC(O)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H22F7NO3/c1-16-5-2-8-19(11-16)35-20-9-4-7-18(13-20)33(15-22(34)24(28,29)30)14-17-6-3-10-21(12-17)36-25(31,32)23(26)27/h2-13,22-23,34H,14-15H2,1H3 |
| InChIKey | CLPUWZXVKKDOLP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|