C27H23FN2O6S — CID 10165040
1-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]-5-methoxyindole-2,3-dione (PubChem CID 10165040) has the molecular formula C27H23FN2O6S and a molecular weight of 522.55 g/mol. Its IUPAC name is 1-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]-5-methoxyindole-2,3-dione.
| Compound Name | 1-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]-5-methoxyindole-2,3-dione |
|---|---|
| PubChem CID | 10165040 |
| Molecular Formula | C27H23FN2O6S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 1-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]-5-methoxyindole-2,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2C1CCCN(c2ccc(-c3ccccc3S(C)(=O)=O)cc2F)C1=O |
| InChI | InChI=1S/C27H23FN2O6S/c1-36-17-10-12-21-19(15-17)25(31)27(33)30(21)23-7-5-13-29(26(23)32)22-11-9-16(14-20(22)28)18-6-3-4-8-24(18)37(2,34)35/h3-4,6,8-12,14-15,23H,5,7,13H2,1-2H3 |
| InChIKey | UJZJALLTVSODBU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|