C21H22Br2N2O4 — CID 10165199
2-[3-[4-[(3,5-dibromophenyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide (PubChem CID 10165199) has the molecular formula C21H22Br2N2O4 and a molecular weight of 526.23 g/mol. Its IUPAC name is 2-[3-[4-[(3,5-dibromophenyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide.
| Compound Name | 2-[3-[4-[(3,5-dibromophenyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10165199 |
| Molecular Formula | C21H22Br2N2O4 |
| Molecular Weight | 526.23 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | 2-[3-[4-[(3,5-dibromophenyl)methoxy]phenyl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N1CCC(C)(c2ccc(OCc3cc(Br)cc(Br)c3)cc2)C1=O |
| InChI | InChI=1S/C21H22Br2N2O4/c1-13(19(26)24-28)25-8-7-21(2,20(25)27)15-3-5-18(6-4-15)29-12-14-9-16(22)11-17(23)10-14/h3-6,9-11,13,28H,7-8,12H2,1-2H3,(H,24,26) |
| InChIKey | IVYXMVGUGSMOPZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|