C28H41N5O5 — CID 10165275
4-(3,4-diethoxyphenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 10165275) has the molecular formula C28H41N5O5 and a molecular weight of 527.67 g/mol. Its IUPAC name is 4-(3,4-diethoxyphenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | 4-(3,4-diethoxyphenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10165275 |
| Molecular Formula | C28H41N5O5 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 4-(3,4-diethoxyphenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | CCOc1ccc(C2=NN(N3CCN(C(=O)CN4CCOCC4)CC3)C(=O)C3CCCCC23)cc1OCC |
| InChI | InChI=1S/C28H41N5O5/c1-3-37-24-10-9-21(19-25(24)38-4-2)27-22-7-5-6-8-23(22)28(35)33(29-27)32-13-11-31(12-14-32)26(34)20-30-15-17-36-18-16-30/h9-10,19,22-23H,3-8,11-18,20H2,1-2H3 |
| InChIKey | HZJJNUJUIJYUBX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |