C25H22F4N6O3 — CID 10165368
[6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(piperazin-1-ylmethylidene)carbamate (PubChem CID 10165368) has the molecular formula C25H22F4N6O3 and a molecular weight of 530.48 g/mol. Its IUPAC name is [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(piperazin-1-ylmethylidene)carbamate.
| Compound Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(piperazin-1-ylmethylidene)carbamate |
|---|---|
| PubChem CID | 10165368 |
| Molecular Formula | C25H22F4N6O3 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(piperazin-1-ylmethylidene)carbamate |
| SMILES | NC(=O)N(c1ccc(COC(=O)/N=C/N2CCNCC2)c(-c2ccc(F)cc2F)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C25H22F4N6O3/c26-16-5-6-17(20(29)12-16)22-15(13-38-25(37)32-14-34-10-8-31-9-11-34)4-7-21(33-22)35(24(30)36)23-18(27)2-1-3-19(23)28/h1-7,12,14,31H,8-11,13H2,(H2,30,36)/b32-14+ |
| InChIKey | GRFBWGLAOJFXRK-HIWRWHBISA-N |
| XLogP | 4.09 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|