C22H22BrN5O2S2 — CID 10165455
1-[4-[5-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylbenzoyl]piperazin-1-yl]ethanone (PubChem CID 10165455) has the molecular formula C22H22BrN5O2S2 and a molecular weight of 532.49 g/mol. Its IUPAC name is 1-[4-[5-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylbenzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[5-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylbenzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 10165455 |
| Molecular Formula | C22H22BrN5O2S2 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 1-[4-[5-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylbenzoyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cc(Sc3cnc(Nc4cccc(Br)n4)s3)ccc2C)CC1 |
| InChI | InChI=1S/C22H22BrN5O2S2/c1-14-6-7-16(12-17(14)21(30)28-10-8-27(9-11-28)15(2)29)31-20-13-24-22(32-20)26-19-5-3-4-18(23)25-19/h3-7,12-13H,8-11H2,1-2H3,(H,24,25,26) |
| InChIKey | WAIWXFGIIWQVMF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|