C28H24N8O4 — CID 10165611
2,4,11,13,20,22,29,31-octazapentacyclo[30.4.0.05,10.014,19.023,28]hexatriaconta-1(36),5,7,9,14,16,18,23,25,27,32,34-dodecaene-3,12,21,30-tetrone (PubChem CID 10165611) has the molecular formula C28H24N8O4 and a molecular weight of 536.55 g/mol. Its IUPAC name is 2,4,11,13,20,22,29,31-octazapentacyclo[30.4.0.05,10.014,19.023,28]hexatriaconta-1(36),5,7,9,14,16,18,23,25,27,32,34-dodecaene-3,12,21,30-tetrone.
| Compound Name | 2,4,11,13,20,22,29,31-octazapentacyclo[30.4.0.05,10.014,19.023,28]hexatriaconta-1(36),5,7,9,14,16,18,23,25,27,32,34-dodecaene-3,12,21,30-tetrone |
|---|---|
| PubChem CID | 10165611 |
| Molecular Formula | C28H24N8O4 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2,4,11,13,20,22,29,31-octazapentacyclo[30.4.0.05,10.014,19.023,28]hexatriaconta-1(36),5,7,9,14,16,18,23,25,27,32,34-dodecaene-3,12,21,30-tetrone |
| SMILES | O=C1Nc2ccccc2NC(=O)Nc2ccccc2NC(=O)Nc2ccccc2NC(=O)Nc2ccccc2N1 |
| InChI | InChI=1S/C28H24N8O4/c37-25-29-17-9-1-2-10-18(17)30-26(38)32-21-13-5-6-14-22(21)34-28(40)36-24-16-8-7-15-23(24)35-27(39)33-20-12-4-3-11-19(20)31-25/h1-16H,(H2,29,31,37)(H2,30,32,38)(H2,33,35,39)(H2,34,36,40) |
| InChIKey | UCANRLOPAKDLFP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 164.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |