C27H36FN5O6 — CID 10165939
[(2R)-1-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-[[(3S)-2-oxopiperidin-3-yl]amino]heptan-3-yl]carbamate (PubChem CID 10165939) has the molecular formula C27H36FN5O6 and a molecular weight of 545.61 g/mol. Its IUPAC name is [(2R)-1-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-[[(3S)-2-oxopiperidin-3-yl]amino]heptan-3-yl]carbamate.
| Compound Name | [(2R)-1-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-[[(3S)-2-oxopiperidin-3-yl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 10165939 |
| Molecular Formula | C27H36FN5O6 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | [(2R)-1-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-[[(3S)-2-oxopiperidin-3-yl]amino]heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)O[C@H](Cc1nnc(-c2ccc(F)cc2)o1)C(C)(C)C)C(=O)C(=O)N[C@H]1CCCNC1=O |
| InChI | InChI=1S/C27H36FN5O6/c1-5-6-8-18(22(34)24(36)30-19-9-7-14-29-23(19)35)31-26(37)38-20(27(2,3)4)15-21-32-33-25(39-21)16-10-12-17(28)13-11-16/h10-13,18-20H,5-9,14-15H2,1-4H3,(H,29,35)(H,30,36)(H,31,37)/t18-,19-,20+/m0/s1 |
| InChIKey | AQMZQDJVQGMOQG-SLFFLAALSA-N |
| XLogP | 3.08 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|