C36H37NO4 — CID 10166030
15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid (PubChem CID 10166030) has the molecular formula C36H37NO4 and a molecular weight of 547.70 g/mol. Its IUPAC name is 15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid.
| Compound Name | 15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid |
|---|---|
| PubChem CID | 10166030 |
| Molecular Formula | C36H37NO4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid |
| SMILES | CCCCCCC(CCCCCC)N1C(=O)c2ccc3c4cccc5c(C(=O)O)ccc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C36H37NO4/c1-3-5-7-9-12-22(13-10-8-6-4-2)37-34(38)29-20-17-26-23-14-11-15-24-28(36(40)41)19-16-25(31(23)24)27-18-21-30(35(37)39)33(29)32(26)27/h11,14-22H,3-10,12-13H2,1-2H3,(H,40,41) |
| InChIKey | PSAWMDGNDYENPM-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|