C35H39N3O3 — CID 10166108
[2-[1-[4-[[4-(4-cyanophenyl)benzoyl]amino]butyl]piperidin-4-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate (PubChem CID 10166108) has the molecular formula C35H39N3O3 and a molecular weight of 549.72 g/mol. Its IUPAC name is [2-[1-[4-[[4-(4-cyanophenyl)benzoyl]amino]butyl]piperidin-4-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate.
| Compound Name | [2-[1-[4-[[4-(4-cyanophenyl)benzoyl]amino]butyl]piperidin-4-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 10166108 |
| Molecular Formula | C35H39N3O3 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | [2-[1-[4-[[4-(4-cyanophenyl)benzoyl]amino]butyl]piperidin-4-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C#N)cc4)cc3)CC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C35H39N3O3/c1-25(39)41-34-32-7-3-2-6-29(32)16-17-33(34)30-18-22-38(23-19-30)21-5-4-20-37-35(40)31-14-12-28(13-15-31)27-10-8-26(24-36)9-11-27/h8-17,30H,2-7,18-23H2,1H3,(H,37,40) |
| InChIKey | IQLPYFRLQPUQEM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|