C31H42N4O3S — CID 10166155
N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 10166155) has the molecular formula C31H42N4O3S and a molecular weight of 550.77 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 10166155 |
| Molecular Formula | C31H42N4O3S |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)N[C@H]1CCCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)CN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C31H42N4O3S/c1-21(2)18-27(28(36)20-35-17-9-12-22-10-4-5-11-23(22)19-35)34-29(37)24-13-6-7-15-26(24)33-30(38)25-14-8-16-32-31(25)39-3/h4-5,8,10-11,14,16,21,24,26-27H,6-7,9,12-13,15,17-20H2,1-3H3,(H,33,38)(H,34,37)/t24-,26+,27+/m1/s1 |
| InChIKey | NJJAZVVLMMBUBZ-STXQHDJLSA-N |
| XLogP | 4.64 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |