C23H23Cl2N3O5S2 — CID 10166331
N-(2-acetyl-4,6-dimethylphenyl)-5-chloro-3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 10166331) has the molecular formula C23H23Cl2N3O5S2 and a molecular weight of 556.49 g/mol. Its IUPAC name is N-(2-acetyl-4,6-dimethylphenyl)-5-chloro-3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-acetyl-4,6-dimethylphenyl)-5-chloro-3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 10166331 |
| Molecular Formula | C23H23Cl2N3O5S2 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | N-(2-acetyl-4,6-dimethylphenyl)-5-chloro-3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sc2c(c1S(=O)(=O)Nc1onc(C)c1Cl)CC(Cl)CC2 |
| InChI | InChI=1S/C23H23Cl2N3O5S2/c1-10-7-11(2)19(15(8-10)13(4)29)26-22(30)20-21(16-9-14(24)5-6-17(16)34-20)35(31,32)28-23-18(25)12(3)27-33-23/h7-8,14,28H,5-6,9H2,1-4H3,(H,26,30) |
| InChIKey | YDMBSMJQNLDLGG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|