C25H28F6N6O2 — CID 10166396
1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[2-(2H-tetrazol-5-ylmethoxy)ethyl]piperazine (PubChem CID 10166396) has the molecular formula C25H28F6N6O2 and a molecular weight of 558.53 g/mol. Its IUPAC name is 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[2-(2H-tetrazol-5-ylmethoxy)ethyl]piperazine.
| Compound Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[2-(2H-tetrazol-5-ylmethoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 10166396 |
| Molecular Formula | C25H28F6N6O2 |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[2-(2H-tetrazol-5-ylmethoxy)ethyl]piperazine |
| SMILES | FC(F)(F)c1cc(COCC(c2ccccc2)N2CCN(CCOCc3nn[nH]n3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F6N6O2/c26-24(27,28)20-12-18(13-21(14-20)25(29,30)31)15-39-16-22(19-4-2-1-3-5-19)37-8-6-36(7-9-37)10-11-38-17-23-32-34-35-33-23/h1-5,12-14,22H,6-11,15-17H2,(H,32,33,34,35) |
| InChIKey | YBMCOQCVMBVASC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|