C33H30N6O3 — CID 10166409
5-amino-2-[3-[3-[methyl-(8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-10-yl)amino]propylamino]propyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 10166409) has the molecular formula C33H30N6O3 and a molecular weight of 558.64 g/mol. Its IUPAC name is 5-amino-2-[3-[3-[methyl-(8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-10-yl)amino]propylamino]propyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 5-amino-2-[3-[3-[methyl-(8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-10-yl)amino]propylamino]propyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 10166409 |
| Molecular Formula | C33H30N6O3 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 5-amino-2-[3-[3-[methyl-(8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-10-yl)amino]propylamino]propyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CN(CCCNCCCN1C(=O)c2cccc3cc(N)cc(c23)C1=O)c1ccc2ncn3c4ccccc4c(=O)c1c23 |
| InChI | InChI=1S/C33H30N6O3/c1-37(27-12-11-25-30-29(27)31(40)22-8-2-3-10-26(22)39(30)19-36-25)15-5-13-35-14-6-16-38-32(41)23-9-4-7-20-17-21(34)18-24(28(20)23)33(38)42/h2-4,7-12,17-19,35H,5-6,13-16,34H2,1H3 |
| InChIKey | VSZZBOYXMCZAND-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|