C33H46FN3O4 — CID 10166739
14-[2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-4-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione (PubChem CID 10166739) has the molecular formula C33H46FN3O4 and a molecular weight of 567.75 g/mol. Its IUPAC name is 14-[2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-4-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione.
| Compound Name | 14-[2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-4-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
|---|---|
| PubChem CID | 10166739 |
| Molecular Formula | C33H46FN3O4 |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.35 |
| IUPAC Name | 14-[2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-4-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
| SMILES | CCCC1CCNC(=O)CCCC(=O)NC(C(O)CNC2(c3cccc(CC)c3)CC2)Cc2cc(F)cc(c2)OC1 |
| InChI | InChI=1S/C33H46FN3O4/c1-3-7-24-12-15-35-31(39)10-6-11-32(40)37-29(19-25-17-27(34)20-28(18-25)41-22-24)30(38)21-36-33(13-14-33)26-9-5-8-23(4-2)16-26/h5,8-9,16-18,20,24,29-30,36,38H,3-4,6-7,10-15,19,21-22H2,1-2H3,(H,35,39)(H,37,40) |
| InChIKey | UPXCKCHWKQPDRD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |