C21H26N9O7PS — CID 10167067
(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,3S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]oxolan-3-ol (PubChem CID 10167067) has the molecular formula C21H26N9O7PS and a molecular weight of 579.54 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,3S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,3S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 10167067 |
| Molecular Formula | C21H26N9O7PS |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,3S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]oxolan-3-ol |
| SMILES | Nc1ncnc2c1ccn2[C@H]1C[C@H](OP(O)(=S)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C[C@@H]2O)[C@@H](CO)O1 |
| InChI | InChI=1S/C21H26N9O7PS/c22-18-10-1-2-29(20(10)26-7-24-18)16-4-12(13(5-31)35-16)37-38(33,39)34-6-14-11(32)3-15(36-14)30-9-28-17-19(23)25-8-27-21(17)30/h1-2,7-9,11-16,31-32H,3-6H2,(H,33,39)(H2,22,24,26)(H2,23,25,27)/t11-,12-,13+,14+,15+,16+,38?/m0/s1 |
| InChIKey | MKMYFBYQEJBOMK-LLKNLUPTSA-N |
| XLogP | -0.02 |
| TPSA | 223.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|