C31H29N3O4S3 — CID 10167673
(2Z,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one;4-methylbenzenesulfonate (PubChem CID 10167673) has the molecular formula C31H29N3O4S3 and a molecular weight of 603.79 g/mol. Its IUPAC name is (2Z,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one;4-methylbenzenesulfonate.
| Compound Name | (2Z,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10167673 |
| Molecular Formula | C31H29N3O4S3 |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | (2Z,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one;4-methylbenzenesulfonate |
| SMILES | CCn1c(=O)/c(=C2\Sc3ccccc3N2C)s/c1=C\c1cc[n+](C)c2ccccc12.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C24H22N3OS2.C7H8O3S/c1-4-27-21(15-16-13-14-25(2)18-10-6-5-9-17(16)18)30-22(23(27)28)24-26(3)19-11-7-8-12-20(19)29-24;1-6-2-4-7(5-3-6)11(8,9)10/h5-15H,4H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b24-22+; |
| InChIKey | ZAQBTIITDFSVPQ-HDPAMLMOSA-M |
| XLogP | 3.94 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|