About CID 10167731
CID 10167731 (PubChem CID 10167731) has the molecular formula C36H56FeP2+2
and a molecular weight of 606.64 g/mol.
Molecular Properties
| Compound Name | CID 10167731 |
| PubChem CID | 10167731 |
| Molecular Formula | C36H56FeP2+2 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | — |
| SMILES | C[C@H]([C]1[CH][CH][CH][C]1P(C1CCCCC1)C1CCCCC1)P(C1CCCCC1)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C31H51P2.C5H5.Fe/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29;1-2-4-5-3-1;/h14,23-29H,2-13,15-22H2,1H3;1-5H;/q;;+2/t25-;;/m1../s1 |
| InChIKey | YWLTYPQLBDYENR-KHZPMNTOSA-N |
| XLogP | 11.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 10167731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10167731?
The IUPAC name of CID 10167731 (CID 10167731) is not available.
What is the SMILES notation for CID 10167731?
The canonical SMILES for CID 10167731 is C[C@H]([C]1[CH][CH][CH][C]1P(C1CCCCC1)C1CCCCC1)P(C1CCCCC1)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10167731?
The InChIKey is YWLTYPQLBDYENR-KHZPMNTOSA-N. The full InChI is InChI=1S/C31H51P2.C5H5.Fe/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29;1-2-4-5-3-1;/h14,23-29H,2-13,15-22H2,1H3;1-5H;/q;;+2/t25-;;/m1../s1.
What are the key properties of CID 10167731?
CID 10167731 has a molecular weight of 606.64 g/mol, XLogP of 11.42, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10167731 is sourced from PubChem (CID 10167731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).