C37H47N5O3 — CID 10167801
N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide (PubChem CID 10167801) has the molecular formula C37H47N5O3 and a molecular weight of 609.82 g/mol. Its IUPAC name is N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide.
| Compound Name | N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 10167801 |
| Molecular Formula | C37H47N5O3 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.37 |
| IUPAC Name | N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide |
| SMILES | CCCCNC(=O)C(Cc1ccc(O)cc1)NC(=O)CCCCCc1cc(-c2ccccn2)nn1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H47N5O3/c1-5-6-23-39-36(45)34(25-27-15-21-31(43)22-16-27)40-35(44)14-9-7-8-12-30-26-33(32-13-10-11-24-38-32)41-42(30)29-19-17-28(18-20-29)37(2,3)4/h10-11,13,15-22,24,26,34,43H,5-9,12,14,23,25H2,1-4H3,(H,39,45)(H,40,44) |
| InChIKey | JZJUJWKACGZRIX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|