C32H41F5O5 — CID 10168038
11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid (PubChem CID 10168038) has the molecular formula C32H41F5O5 and a molecular weight of 600.67 g/mol. Its IUPAC name is 11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid.
| Compound Name | 11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
|---|---|
| PubChem CID | 10168038 |
| Molecular Formula | C32H41F5O5 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
| SMILES | C[C@]1(c2ccc(O)cc2)COc2cc(O)ccc2[C@H]1CCCCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C32H41F5O5/c1-30(23-13-15-24(38)16-14-23)21-42-28-20-25(39)17-18-26(28)27(30)12-8-6-4-2-3-5-7-10-22(29(40)41)11-9-19-31(33,34)32(35,36)37/h13-18,20,22,27,38-39H,2-12,19,21H2,1H3,(H,40,41)/t22?,27-,30-/m1/s1 |
| InChIKey | INZIEWHVBPCAIT-SQEVJMJHSA-N |
| XLogP | 9.11 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|