C36H46N6O5 — CID 10168344
(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide (PubChem CID 10168344) has the molecular formula C36H46N6O5 and a molecular weight of 642.80 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide.
| Compound Name | (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 10168344 |
| Molecular Formula | C36H46N6O5 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](C)N)C(N)=O |
| InChI | InChI=1S/C36H46N6O5/c1-23(2)19-28(32(38)43)39-34(45)30(21-26-15-9-5-10-16-26)41-36(47)31(22-27-17-11-6-12-18-27)42-35(46)29(40-33(44)24(3)37)20-25-13-7-4-8-14-25/h4-18,23-24,28-31H,19-22,37H2,1-3H3,(H2,38,43)(H,39,45)(H,40,44)(H,41,47)(H,42,46)/t24-,28-,29-,30-,31-/m1/s1 |
| InChIKey | AYUITQFPFCWMLO-HSULIJPJSA-N |
| XLogP | 1.53 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |