C9H12Br6N2O2 — CID 10168574
2,2,2-tribromo-N-[2,2-dimethyl-3-[(2,2,2-tribromoacetyl)amino]propyl]acetamide (PubChem CID 10168574) has the molecular formula C9H12Br6N2O2 and a molecular weight of 659.63 g/mol. Its IUPAC name is 2,2,2-tribromo-N-[2,2-dimethyl-3-[(2,2,2-tribromoacetyl)amino]propyl]acetamide.
| Compound Name | 2,2,2-tribromo-N-[2,2-dimethyl-3-[(2,2,2-tribromoacetyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 10168574 |
| Molecular Formula | C9H12Br6N2O2 |
| Molecular Weight | 659.63 g/mol |
| Exact Mass | 653.60 |
| IUPAC Name | 2,2,2-tribromo-N-[2,2-dimethyl-3-[(2,2,2-tribromoacetyl)amino]propyl]acetamide |
| SMILES | CC(C)(CNC(=O)C(Br)(Br)Br)CNC(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C9H12Br6N2O2/c1-7(2,3-16-5(18)8(10,11)12)4-17-6(19)9(13,14)15/h3-4H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | GWOIYILYHFGQGM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|