C43H53N3O4 — CID 10168742
[1-[8-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10168742) has the molecular formula C43H53N3O4 and a molecular weight of 675.91 g/mol. Its IUPAC name is [1-[8-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[8-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10168742 |
| Molecular Formula | C43H53N3O4 |
| Molecular Weight | 675.91 g/mol |
| Exact Mass | 675.40 |
| IUPAC Name | [1-[8-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CC1(OC(=O)Nc2ccccc2-c2ccccc2)CCN(CCCCCCCCN2CCc3cc(O)c(O)cc3C(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C43H53N3O4/c1-43(50-42(49)44-39-21-13-12-20-36(39)33-16-8-6-9-17-33)23-28-45(29-24-43)25-14-4-2-3-5-15-26-46-27-22-35-30-40(47)41(48)31-37(35)38(32-46)34-18-10-7-11-19-34/h6-13,16-21,30-31,38,47-48H,2-5,14-15,22-29,32H2,1H3,(H,44,49) |
| InChIKey | CYFDQVWYZCYGCR-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.91 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|