C33H39F9O5 — CID 10168845
10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)decanoic acid (PubChem CID 10168845) has the molecular formula C33H39F9O5 and a molecular weight of 686.65 g/mol. Its IUPAC name is 10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)decanoic acid.
| Compound Name | 10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)decanoic acid |
|---|---|
| PubChem CID | 10168845 |
| Molecular Formula | C33H39F9O5 |
| Molecular Weight | 686.65 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | 10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)decanoic acid |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C33H39F9O5/c1-29(22-12-14-23(43)15-13-22)20-47-27-19-24(44)16-17-25(27)26(29)11-7-5-3-2-4-6-9-21(28(45)46)10-8-18-30(34,35)31(36,37)32(38,39)33(40,41)42/h12-17,19,21,26,43-44H,2-11,18,20H2,1H3,(H,45,46) |
| InChIKey | FRLMDRRZJLMNHF-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.65 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|