C43H84N4O2 — CID 10168874
2,6-diamino-N,N'-bis[(Z)-octadec-9-enyl]heptanediamide (PubChem CID 10168874) has the molecular formula C43H84N4O2 and a molecular weight of 689.17 g/mol. Its IUPAC name is 2,6-diamino-N,N'-bis[(Z)-octadec-9-enyl]heptanediamide.
| Compound Name | 2,6-diamino-N,N'-bis[(Z)-octadec-9-enyl]heptanediamide |
|---|---|
| PubChem CID | 10168874 |
| Molecular Formula | C43H84N4O2 |
| Molecular Weight | 689.17 g/mol |
| Exact Mass | 688.66 |
| IUPAC Name | 2,6-diamino-N,N'-bis[(Z)-octadec-9-enyl]heptanediamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)C(N)CCCC(N)C(=O)NCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H84N4O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-46-42(48)40(44)36-35-37-41(45)43(49)47-39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,40-41H,3-16,21-39,44-45H2,1-2H3,(H,46,48)(H,47,49)/b19-17-,20-18- |
| InChIKey | HKHOKGQFKKQRJA-CLFAGFIQSA-N |
| XLogP | 11.12 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.17 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|