C38H38FN5O5S — CID 10168940
1-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]-3-(4-fluorophenyl)-1-hexylurea (PubChem CID 10168940) has the molecular formula C38H38FN5O5S and a molecular weight of 695.82 g/mol. Its IUPAC name is 1-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]-3-(4-fluorophenyl)-1-hexylurea.
| Compound Name | 1-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]-3-(4-fluorophenyl)-1-hexylurea |
|---|---|
| PubChem CID | 10168940 |
| Molecular Formula | C38H38FN5O5S |
| Molecular Weight | 695.82 g/mol |
| Exact Mass | 695.26 |
| IUPAC Name | 1-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]-3-(4-fluorophenyl)-1-hexylurea |
| SMILES | CCCCCCN(C(=O)Nc1ccc(F)cc1)c1ccc(Oc2ccc3nc(COc4ccc(CC5SC(=O)NC5=O)cc4)n(C)c3c2)cc1 |
| InChI | InChI=1S/C38H38FN5O5S/c1-3-4-5-6-21-44(37(46)40-27-11-9-26(39)10-12-27)28-13-17-30(18-14-28)49-31-19-20-32-33(23-31)43(2)35(41-32)24-48-29-15-7-25(8-16-29)22-34-36(45)42-38(47)50-34/h7-20,23,34H,3-6,21-22,24H2,1-2H3,(H,40,46)(H,42,45,47) |
| InChIKey | BWFXDAYCCLAJPR-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.82 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|