C38H51N4O12P — CID 10169536
diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)benzoyl]amino]-2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]carbamoyl]benzene-1,3-dicarboxylate (PubChem CID 10169536) has the molecular formula C38H51N4O12P and a molecular weight of 786.82 g/mol. Its IUPAC name is diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)benzoyl]amino]-2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]carbamoyl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)benzoyl]amino]-2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]carbamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10169536 |
| Molecular Formula | C38H51N4O12P |
| Molecular Weight | 786.82 g/mol |
| Exact Mass | 786.32 |
| IUPAC Name | diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)benzoyl]amino]-2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]carbamoyl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)NCC(CNC(=O)c2cc(C(=O)OCC)cc(C(=O)OCC)c2)OP(OCCC#N)N(C(C)C)C(C)C)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C38H51N4O12P/c1-9-49-35(45)28-16-26(17-29(20-28)36(46)50-10-2)33(43)40-22-32(54-55(53-15-13-14-39)42(24(5)6)25(7)8)23-41-34(44)27-18-30(37(47)51-11-3)21-31(19-27)38(48)52-12-4/h16-21,24-25,32H,9-13,15,22-23H2,1-8H3,(H,40,43)(H,41,44) |
| InChIKey | VKMVLFPHOKPNKJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 208.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.82 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|