C20H7Cl2I4O5+ — CID 10170097
3,5-dichloro-2-(3,6-dihydroxy-2,4,5,7-tetraiodoxanthen-10-ium-9-yl)benzoic acid (PubChem CID 10170097) has the molecular formula C20H7Cl2I4O5+ and a molecular weight of 905.79 g/mol. Its IUPAC name is 3,5-dichloro-2-(3,6-dihydroxy-2,4,5,7-tetraiodoxanthen-10-ium-9-yl)benzoic acid.
| Compound Name | 3,5-dichloro-2-(3,6-dihydroxy-2,4,5,7-tetraiodoxanthen-10-ium-9-yl)benzoic acid |
|---|---|
| PubChem CID | 10170097 |
| Molecular Formula | C20H7Cl2I4O5+ |
| Molecular Weight | 905.79 g/mol |
| Exact Mass | 904.58 |
| IUPAC Name | 3,5-dichloro-2-(3,6-dihydroxy-2,4,5,7-tetraiodoxanthen-10-ium-9-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1-c1c2cc(I)c(O)c(I)c2[o+]c2c(I)c(O)c(I)cc12 |
| InChI | InChI=1S/C20H6Cl2I4O5/c21-5-1-8(20(29)30)13(9(22)2-5)12-6-3-10(23)16(27)14(25)18(6)31-19-7(12)4-11(24)17(28)15(19)26/h1-4H,(H2-,27,28,29,30)/p+1 |
| InChIKey | CZDUBDUPHVHFBV-UHFFFAOYSA-O |
| XLogP | 8.37 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.79 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|