About (213C)1H-pyrimidine-2,4-dione
(213C)1H-pyrimidine-2,4-dione (PubChem CID 10171240) has the molecular formula C4H4N2O2
and a molecular weight of 113.08 g/mol. Its IUPAC name is (213C)1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | (213C)1H-pyrimidine-2,4-dione |
| PubChem CID | 10171240 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 113.08 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | (213C)1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc[nH][13c](=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i4+1 |
| InChIKey | ISAKRJDGNUQOIC-AZXPZELESA-N |
| XLogP | -0.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.08 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (213C)1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (213C)1H-pyrimidine-2,4-dione?
The IUPAC name of (213C)1H-pyrimidine-2,4-dione (CID 10171240) is (213C)1H-pyrimidine-2,4-dione.
What is the SMILES notation for (213C)1H-pyrimidine-2,4-dione?
The canonical SMILES for (213C)1H-pyrimidine-2,4-dione is O=c1cc[nH][13c](=O)[nH]1.
What is the InChIKey of (213C)1H-pyrimidine-2,4-dione?
The InChIKey is ISAKRJDGNUQOIC-AZXPZELESA-N. The full InChI is InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i4+1.
What are the key properties of (213C)1H-pyrimidine-2,4-dione?
(213C)1H-pyrimidine-2,4-dione has a molecular weight of 113.08 g/mol, XLogP of -0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (213C)1H-pyrimidine-2,4-dione is sourced from PubChem (CID 10171240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).