About 2-aminopentanenitrile
2-aminopentanenitrile (PubChem CID 10171288) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 2-aminopentanenitrile.
Molecular Properties
| Compound Name | 2-aminopentanenitrile |
| PubChem CID | 10171288 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2-aminopentanenitrile |
| SMILES | CCCC(N)C#N |
| InChI | InChI=1S/C5H10N2/c1-2-3-5(7)4-6/h5H,2-3,7H2,1H3 |
| InChIKey | RPMBPYXLPIWSFJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminopentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanenitrile?
The IUPAC name of 2-aminopentanenitrile (CID 10171288) is 2-aminopentanenitrile.
What is the SMILES notation for 2-aminopentanenitrile?
The canonical SMILES for 2-aminopentanenitrile is CCCC(N)C#N.
What is the InChIKey of 2-aminopentanenitrile?
The InChIKey is RPMBPYXLPIWSFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-2-3-5(7)4-6/h5H,2-3,7H2,1H3.
What are the key properties of 2-aminopentanenitrile?
2-aminopentanenitrile has a molecular weight of 98.15 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanenitrile is sourced from PubChem (CID 10171288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).