C7H4N2OS2 — CID 10171321
1,2,3-benzothiadiazole-7-carbothioic S-acid (PubChem CID 10171321) has the molecular formula C7H4N2OS2 and a molecular weight of 196.26 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole-7-carbothioic S-acid.
| Compound Name | 1,2,3-benzothiadiazole-7-carbothioic S-acid |
|---|---|
| PubChem CID | 10171321 |
| Molecular Formula | C7H4N2OS2 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | 1,2,3-benzothiadiazole-7-carbothioic S-acid |
| SMILES | O=C(S)c1cccc2nnsc12 |
| InChI | InChI=1S/C7H4N2OS2/c10-7(11)4-2-1-3-5-6(4)12-9-8-5/h1-3H,(H,10,11) |
| InChIKey | CGIHPACLZJDCBQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|