About [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine
[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine (PubChem CID 10171585) has the molecular formula C12H16Cl2N2O
and a molecular weight of 275.18 g/mol. Its IUPAC name is [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine.
Molecular Properties
| Compound Name | [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine |
| PubChem CID | 10171585 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine |
| SMILES | NC[C@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C12H16Cl2N2O/c13-11-2-1-9(5-12(11)14)7-16-3-4-17-10(6-15)8-16/h1-2,5,10H,3-4,6-8,15H2/t10-/m0/s1 |
| InChIKey | UANWWXRZQGYWSR-JTQLQIEISA-N |
| XLogP | 2.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine?
The IUPAC name of [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine (CID 10171585) is [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine.
What is the SMILES notation for [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine?
The canonical SMILES for [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine is NC[C@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1.
What is the InChIKey of [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine?
The InChIKey is UANWWXRZQGYWSR-JTQLQIEISA-N. The full InChI is InChI=1S/C12H16Cl2N2O/c13-11-2-1-9(5-12(11)14)7-16-3-4-17-10(6-15)8-16/h1-2,5,10H,3-4,6-8,15H2/t10-/m0/s1.
What are the key properties of [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine?
[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine has a molecular weight of 275.18 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine is sourced from PubChem (CID 10171585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).