About [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine
[4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine (PubChem CID 10171675) has the molecular formula C18H18N4
and a molecular weight of 290.37 g/mol. Its IUPAC name is [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine.
Molecular Properties
| Compound Name | [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine |
| PubChem CID | 10171675 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine |
| SMILES | NCc1nc(-c2ccccc2)nc(-c2ccccc2)c1CN |
| InChI | InChI=1S/C18H18N4/c19-11-15-16(12-20)21-18(14-9-5-2-6-10-14)22-17(15)13-7-3-1-4-8-13/h1-10H,11-12,19-20H2 |
| InChIKey | CRSWCRLCIQQPHF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine?
The IUPAC name of [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine (CID 10171675) is [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine.
What is the SMILES notation for [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine?
The canonical SMILES for [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine is NCc1nc(-c2ccccc2)nc(-c2ccccc2)c1CN.
What is the InChIKey of [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine?
The InChIKey is CRSWCRLCIQQPHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4/c19-11-15-16(12-20)21-18(14-9-5-2-6-10-14)22-17(15)13-7-3-1-4-8-13/h1-10H,11-12,19-20H2.
What are the key properties of [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine?
[4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine has a molecular weight of 290.37 g/mol, XLogP of 2.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)-2,6-diphenylpyrimidin-5-yl]methanamine is sourced from PubChem (CID 10171675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).