C19H20O3 — CID 10171723
(6S,6aR,10aS)-6-(4-hydroxyphenyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol (PubChem CID 10171723) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (6S,6aR,10aS)-6-(4-hydroxyphenyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol.
| Compound Name | (6S,6aR,10aS)-6-(4-hydroxyphenyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol |
|---|---|
| PubChem CID | 10171723 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (6S,6aR,10aS)-6-(4-hydroxyphenyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol |
| SMILES | Oc1ccc([C@H]2Oc3ccc(O)cc3[C@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C19H20O3/c20-13-7-5-12(6-8-13)19-16-4-2-1-3-15(16)17-11-14(21)9-10-18(17)22-19/h5-11,15-16,19-21H,1-4H2/t15-,16+,19+/m0/s1 |
| InChIKey | SHUMXHZGMOYSRM-FRQCXROJSA-N |
| XLogP | 4.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |