C19H20N2O2 — CID 10171839
(4aS,8aR,10aR)-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3,8a-dicarbonitrile (PubChem CID 10171839) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (4aS,8aR,10aR)-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3,8a-dicarbonitrile.
| Compound Name | (4aS,8aR,10aR)-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3,8a-dicarbonitrile |
|---|---|
| PubChem CID | 10171839 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (4aS,8aR,10aR)-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3,8a-dicarbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)CC[C@]3(C#N)CC[C@@H]12 |
| InChI | InChI=1S/C19H20N2O2/c1-17(2)14-5-7-19(11-21)6-4-13(22)8-15(19)18(14,3)9-12(10-20)16(17)23/h8-9,14H,4-7H2,1-3H3/t14-,18-,19+/m0/s1 |
| InChIKey | VWPSPZKMTKVOKR-ZOCIIQOWSA-N |
| XLogP | 3.26 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |