C11H15N5O5S — CID 10172045
5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(methylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 10172045) has the molecular formula C11H15N5O5S and a molecular weight of 329.34 g/mol. Its IUPAC name is 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(methylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
| Compound Name | 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(methylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 10172045 |
| Molecular Formula | C11H15N5O5S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(methylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | CNc1nc(N)nc2c1sc(=O)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H15N5O5S/c1-13-7-6-8(15-10(12)14-7)16(11(20)22-6)9-5(19)4(18)3(2-17)21-9/h3-5,9,17-19H,2H2,1H3,(H3,12,13,14,15)/t3-,4-,5-,9-/m1/s1 |
| InChIKey | WLLCWFCNXQFMOU-UFMOHRQQSA-N |
| XLogP | -1.91 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |