C17H17N3O2S2 — CID 1017224
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 1017224) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 1017224 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CSc2nc3ccc(N)cc3s2)cc1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-22-13-5-2-11(3-6-13)9-19-16(21)10-23-17-20-14-7-4-12(18)8-15(14)24-17/h2-8H,9-10,18H2,1H3,(H,19,21) |
| InChIKey | VNOGTMIXONGPBO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|