C18H20F3N3O4 — CID 10172965
3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione (PubChem CID 10172965) has the molecular formula C18H20F3N3O4 and a molecular weight of 399.37 g/mol. Its IUPAC name is 3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione.
| Compound Name | 3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10172965 |
| Molecular Formula | C18H20F3N3O4 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione |
| SMILES | CCCc1c(OCCCN2C(=O)CCNC2=O)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C18H20F3N3O4/c1-2-4-11-13(6-5-12-15(11)28-23-16(12)18(19,20)21)27-10-3-9-24-14(25)7-8-22-17(24)26/h5-6H,2-4,7-10H2,1H3,(H,22,26) |
| InChIKey | DVGLQYHMVUMBFP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|